4,4,4-trifluoro-2-methyl-1-phenyl-3-(trifluoromethyl)but-2-en-1-one structure
|
Common Name | 4,4,4-trifluoro-2-methyl-1-phenyl-3-(trifluoromethyl)but-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 35444-12-3 | Molecular Weight | 282.18200 | |
| Density | 1.324g/cm3 | Boiling Point | 289.2ºC at 760 mmHg | |
| Molecular Formula | C12H8F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.8ºC | |
| Name | 4,4,4-trifluoro-2-methyl-1-phenyl-3-(trifluoromethyl)but-2-en-1-one |
|---|
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 289.2ºC at 760 mmHg |
| Molecular Formula | C12H8F6O |
| Molecular Weight | 282.18200 |
| Flash Point | 110.8ºC |
| Exact Mass | 282.04800 |
| PSA | 17.07000 |
| LogP | 4.31040 |
| Index of Refraction | 1.434 |
| InChIKey | FNFWBJPDQJXMNI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)=C(C(F)(F)F)C(F)(F)F |
|
~77%
4,4,4-trifluoro... CAS#:35444-12-3 |
| Literature: Ishihara, Takashi; Shinjo, Hiroshi; Inoue, Yoshihisa; Ando, Teiichi Journal of Fluorine Chemistry, 1983 , vol. 22, p. 1 - 20 |
|
~%
4,4,4-trifluoro... CAS#:35444-12-3 |
| Literature: Ishihara, Takashi; Shinjo, Hiroshi; Inoue, Yoshihisa; Ando, Teiichi Journal of Fluorine Chemistry, 1983 , vol. 22, p. 1 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |