1-iodoanthracene-9,10-dione structure
|
Common Name | 1-iodoanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 3485-80-1 | Molecular Weight | 334.10900 | |
| Density | 1.844g/cm3 | Boiling Point | 462.6ºC at 760 mmHg | |
| Molecular Formula | C14H7IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | 1-iodoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.844g/cm3 |
|---|---|
| Boiling Point | 462.6ºC at 760 mmHg |
| Molecular Formula | C14H7IO2 |
| Molecular Weight | 334.10900 |
| Flash Point | 233.6ºC |
| Exact Mass | 333.94900 |
| PSA | 34.14000 |
| LogP | 3.06660 |
| Index of Refraction | 1.72 |
| InChIKey | OZFDRTGKARBHQM-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(I)cccc21 |
| HS Code | 2914700090 |
|---|
|
~85%
1-iodoanthracen... CAS#:3485-80-1 |
| Literature: Krasnokutskaya, Elena A.; Semenischeva, Nadya I.; Filimonov, Victor D.; Knochel, Paul Synthesis, 2007 , # 1 p. 81 - 84 |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-Iodo-anthraquinone |
| 1-Jod-anthrachinon |
| 1-iodoantraquinone |
| 1-iodoanthra-9,10-quinone |
| 1-iodo-9-anthraquinone |
| Anthraquinone,1-iodo |
| 1-iodo-9,10-anthraquinone |
| 9,1-iodo |