2,3,4,6-Tetraiodobenzoic acid butyl ester structure
|
Common Name | 2,3,4,6-Tetraiodobenzoic acid butyl ester | ||
|---|---|---|---|---|
| CAS Number | 34869-32-4 | Molecular Weight | 681.81400 | |
| Density | 2.571g/cm3 | Boiling Point | 502ºC at 760 mmHg | |
| Molecular Formula | C11H10I4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.4ºC | |
| Name | butyl 2,3,4,6-tetraiodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.571g/cm3 |
|---|---|
| Boiling Point | 502ºC at 760 mmHg |
| Molecular Formula | C11H10I4O2 |
| Molecular Weight | 681.81400 |
| Flash Point | 257.4ºC |
| Exact Mass | 681.68600 |
| PSA | 26.30000 |
| LogP | 5.06190 |
| Index of Refraction | 1.709 |
| InChIKey | DMTBZBBVYHFVLH-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1c(I)cc(I)c(I)c1I |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2,3,4,6-tetraiodo-,butyl ester |