2,5-dichlorobiphenyl
2,5-dichlorobiphenyl structure
|
Common Name | 2,5-dichlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 34883-39-1 | Molecular Weight | 223.09800 | |
| Density | 1.249 g/cm3 | Boiling Point | 303.5ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2 | Melting Point | 22.5°C | |
| MSDS | N/A | Flash Point | 133.7ºC | |
Summary: 2,5-dichlorobiphenyl (CAS number: 34883-39-1) is an organic compound with molecular formula C12H8Cl2 and molecular weight 223.09800. Its melting point is 22.5°C, and the boiling point is 303.5°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-dichlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.249 g/cm3 |
|---|---|
| Boiling Point | 303.5ºC at 760 mmHg |
| Melting Point | 22.5°C |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.09800 |
| Flash Point | 133.7ºC |
| Exact Mass | 222.00000 |
| LogP | 4.66040 |
| Index of Refraction | 1.594 |
| InChIKey | KKQWHYGECTYFIA-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(-c2ccccc2)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R33 |
| Safety Phrases | 35-60-61 |
| RIDADR | UN 2315 |
| Packaging Group | II |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Octanol-water partition coefficient, log P of the compound
Source: ChEMBL
Target: N/A
External Id: CHEMBL1798350
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-chlorobiphenyl |
| 2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE |
| 1,4-dichloro-2-phenylbenzene |
| 2,5-Dichlor-biphenyl |
| 2,5-Dichloro-1,1'-biphenyl |
| 3,6-Dichlorobiphenyl |
| 1,1'-Biphenyl,2,5-dichloro |
| 2,5-dichloro-biphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2,5-dichlorobiphenyl? |
| A: Boiling point of 2,5-dichlorobiphenyl is 303.5ºC at 760 mmHg. |
| Q: What is the melting point of 2,5-dichlorobiphenyl? |
| A: Melting point of 2,5-dichlorobiphenyl is 22.5°C. |
| Q: What English synonyms does 2,5-dichlorobiphenyl have? |
| A: English synonyms of 2,5-dichlorobiphenyl: 2,5-chlorobiphenyl, 2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE, 1,4-dichloro-2-phenylbenzene, 2,5-Dichlor-biphenyl, 2,5-Dichloro-1,1'-biphenyl, 3,6-Dichlorobiphenyl, 1,1'-Biphenyl,2,5-dichloro, 2,5-dichloro-biphenyl. |
| Q: What is the molecular formula of 2,5-dichlorobiphenyl? |
| A: Molecular formula of 2,5-dichlorobiphenyl is C12H8Cl2. |
| Q: What is the CAS number of 2,5-dichlorobiphenyl? |
| A: CAS number of 2,5-dichlorobiphenyl is 34883-39-1. |
| Q: What is the InChIKey of 2,5-dichlorobiphenyl? |
| A: InChIKey of 2,5-dichlorobiphenyl is KKQWHYGECTYFIA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,5-dichlorobiphenyl? |
| A: Molecular weight of 2,5-dichlorobiphenyl is 223.09800. |
| Q: What is the LogP of 2,5-dichlorobiphenyl? |
| A: LogP of 2,5-dichlorobiphenyl is 4.66040. |
| Q: What is the safety information for 2,5-dichlorobiphenyl? |
| A: Safety information for 2,5-dichlorobiphenyl: 35-60-61. |
| Q: What is the SMILES notation of 2,5-dichlorobiphenyl? |
| A: SMILES notation of 2,5-dichlorobiphenyl is Clc1ccc(Cl)c(-c2ccccc2)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |