4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 349-22-4 | Molecular Weight | 210.20200 | |
| Density | 1.243g/cm3 | Boiling Point | 391.3ºC at 760 mmHg | |
| Molecular Formula | C11H11FO3 | Melting Point | 119 °C | |
| MSDS | N/A | Flash Point | 190.4ºC | |
| Name | 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 391.3ºC at 760 mmHg |
| Melting Point | 119 °C |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20200 |
| Flash Point | 190.4ºC |
| Exact Mass | 210.06900 |
| PSA | 54.37000 |
| LogP | 2.18160 |
| Index of Refraction | 1.526 |
| InChIKey | RDWYSVCUOZOEBC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)CCC(=O)O)ccc1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(4-Fluoro-3-methyl-phenyl)-4-oxo-butyric acid |
| 4-(4-Fluor-3-methyl-phenyl)-4-oxo-buttersaeure |