phenyl di(p-tolyl) phosphate
Modify Date: 2025-10-27 12:26:37
phenyl di(p-tolyl) phosphate structure
|
Common Name | phenyl di(p-tolyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 34909-69-8 | Molecular Weight | 354.33600 | |
| Density | 1.22g/cm3 | Boiling Point | 421.9ºC at 760mmHg | |
| Molecular Formula | C20H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | bis(4-methylphenyl) phenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 421.9ºC at 760mmHg |
| Molecular Formula | C20H19O4P |
| Molecular Weight | 354.33600 |
| Flash Point | 222.3ºC |
| Exact Mass | 354.10200 |
| PSA | 54.57000 |
| LogP | 5.94830 |
| Index of Refraction | 1.584 |
| InChIKey | NVMHZSCMWYZDCC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(Oc2ccccc2)Oc2ccc(C)cc2)cc1 |
| HS Code | 2919900090 |
|---|
|
~%
phenyl di(p-tol... CAS#:34909-69-8 |
| Literature: Luff; Kipping Journal of the Chemical Society, 1909 , vol. 95, p. 2003 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| EINECS 252-280-0 |
| Phenyl-di-p-tolyl-phosphat |
| Monophenyl ditolyl phosphate |
| Phosphorsaeure-phenylester-di-p-tolylester |
| phosphoric acid phenyl ester-di-p-tolyl ester |