CHEMBRDG-BB 5356798 structure
|
Common Name | CHEMBRDG-BB 5356798 | ||
|---|---|---|---|---|
| CAS Number | 349404-53-1 | Molecular Weight | 247.71900 | |
| Density | 1.175g/cm3 | Boiling Point | 367.8ºC at 760 mmHg | |
| Molecular Formula | C11H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | Ethyl 1-(3-chloropropanoyl)piperidine-4-carboxylate |
|---|
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 367.8ºC at 760 mmHg |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.71900 |
| Flash Point | 176.3ºC |
| Exact Mass | 247.09800 |
| PSA | 46.61000 |
| LogP | 1.35490 |
| Index of Refraction | 1.489 |
| InChIKey | RQAVOJRSNJZSIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C(=O)CCCl)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |