1,1,3,3-tetraethyl pent-1-ene-1,1,3,3-tetracarboxylate structure
|
Common Name | 1,1,3,3-tetraethyl pent-1-ene-1,1,3,3-tetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 34993-74-3 | Molecular Weight | 358.38400 | |
| Density | 1.132g/cm3 | Boiling Point | 375.6ºC at 760 mmHg | |
| Molecular Formula | C17H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | tetraethyl pent-1-ene-1,1,3,3-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 375.6ºC at 760 mmHg |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.38400 |
| Flash Point | 158.3ºC |
| Exact Mass | 358.16300 |
| PSA | 105.20000 |
| LogP | 1.56160 |
| Index of Refraction | 1.466 |
| InChIKey | QKNBSVJRMBBCKM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC(CC)(C(=O)OCC)C(=O)OCC)C(=O)OCC |
|
~%
1,1,3,3-tetraet... CAS#:34993-74-3 |
| Literature: Lukes et al. Collection of Czechoslovak Chemical Communications, 1959 , vol. 24, p. 1695,1697, 1699 |
|
~%
1,1,3,3-tetraet... CAS#:34993-74-3 |
| Literature: Pettit; Quinn; Smith; Brown The Journal of organic chemistry, 1972 , vol. 37, # 17 p. 2789 - 2791 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| pent-1-ene-1,1,3,3-tetracarboxylic acid tetraethyl ester |
| Pent-1-en-1,1,3,3-tetracarbonsaeure-tetraaethylester |