Cucurbitadienol structure
|
Common Name | Cucurbitadienol | ||
|---|---|---|---|---|
| CAS Number | 35012-08-9 | Molecular Weight | 426.72 | |
| Density | 0.98±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C30H50O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CucurbitadienolCucurbitadienol (10α-Cucurbitadienol) is a natural product that can be found in the seeds of Trichosanthes kirilowii. Cucurbitadienol exhibits anti-inflammatory effect[1]. |
| Name | 10α-cucurbitadienol |
|---|---|
| Synonym | More Synonyms |
| Description | Cucurbitadienol (10α-Cucurbitadienol) is a natural product that can be found in the seeds of Trichosanthes kirilowii. Cucurbitadienol exhibits anti-inflammatory effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.98±0.1 g/cm3 |
|---|---|
| Molecular Formula | C30H50O |
| Molecular Weight | 426.72 |
| Exact Mass | 426.38600 |
| PSA | 20.23000 |
| LogP | 8.33500 |
| InChIKey | WSPRAEIJBDUDRX-FBJXRMALSA-N |
| SMILES | CC(C)=CCCC(C)C1CCC2(C)C3CC=C4C(CCC(O)C4(C)C)C3(C)CCC12C |
| Water Solubility | Insuluble (8.1E-7 g/L) (25 ºC) |
| 10α-cucurbita-5,24-diene-3β-ol |
| 10α-cucurbita-5,24-dien-3β-ol |
| 10α-cucurbita-5,24-dien-3-ol |
| Cucurbitadienol |
| Anhydrolitsomentol |