2-(methylaminomethyl)-4-nitro-phenol structure
|
Common Name | 2-(methylaminomethyl)-4-nitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 35039-53-3 | Molecular Weight | 182.17700 | |
| Density | 1.288g/cm3 | Boiling Point | 349.2ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 2-(methylaminomethyl)-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760 mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 165ºC |
| Exact Mass | 182.06900 |
| PSA | 78.08000 |
| LogP | 1.93390 |
| Index of Refraction | 1.591 |
| InChIKey | GBBPFSWFIBWIHC-UHFFFAOYSA-N |
| SMILES | CNCc1cc([N+](=O)[O-])ccc1O |
|
~48%
2-(methylaminom... CAS#:35039-53-3 |
| Literature: Angelo, Mario M.; Ortwine, Daniel; Worth, Donald F.; Werbel, Leslie M. Journal of Medicinal Chemistry, 1983 , vol. 26, # 9 p. 1311 - 1316 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-<(methylamino)methyl>-4-nitrophenol |
| N-Methyl-2-hydroxy-5-nitrobenzylamin |
| N-methyl-2-hydroxy-5-nitrobenzylamine |