[4-(3-bromophenyl)butan-2-ylideneamino]urea structure
|
Common Name | [4-(3-bromophenyl)butan-2-ylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 3506-71-6 | Molecular Weight | 284.15200 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(E)-4-(3-bromophenyl)butan-2-ylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C11H14BrN3O |
| Molecular Weight | 284.15200 |
| Exact Mass | 283.03200 |
| PSA | 67.48000 |
| LogP | 3.51710 |
| Index of Refraction | 1.597 |
| InChIKey | VMSQGBCHISOCIC-ZSOIEALJSA-N |
| SMILES | CC(CCc1cccc(Br)c1)=NNC(N)=O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Brom-benzylaceton-semicarbazon |