Hexamethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] structure
|
Common Name | Hexamethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] | ||
|---|---|---|---|---|
| CAS Number | 35074-77-2 | Molecular Weight | 638.91700 | |
| Density | 1.032 g/cm3 | Boiling Point | 648.1ºC at 760 mmHg | |
| Molecular Formula | C40H62O6 | Melting Point | 104-108ºC | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | 6-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]hexyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.032 g/cm3 |
|---|---|
| Boiling Point | 648.1ºC at 760 mmHg |
| Melting Point | 104-108ºC |
| Molecular Formula | C40H62O6 |
| Molecular Weight | 638.91700 |
| Flash Point | 180.7ºC |
| Exact Mass | 638.45500 |
| PSA | 93.06000 |
| LogP | 9.50000 |
| Index of Refraction | 1.518 |
| InChIKey | ZVVFVKJZNVSANF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCC(=O)OCCCCCCOC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918290000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Irganox 249 |
| 1,6-hexamethylene bis-(3,5-di-tert-butyl-4-hydroxyhydrocinnamate) |
| EINECS 252-346-9 |
| Irganox 259 |
| Benzenepropanoic acid,3,5-bis(1,1-dimethylethyl)-4-hydroxy-,1,6-hexanediyl ester |
| 1,6-hexamethylene bis(3,5-di-t-butyl-4-hydroxyhydrocinnamate) |
| 1,6-hexanediol-bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] |
| Hexamethylene bis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate) |
| 1,6-Hexamethylenebis(3,5-tert-butyl-4-hydroxyhydrocinnamate) |
| 1,6-Hexanediyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate |
| Hexamethylene bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate) |
| 6-hexanediol-bis-3-(3,5-di-t-butyl-4-hydroxyphenyl) propionate |
| Hexamethylene bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] |