Parathion-ethyl-d10 structure
|
Common Name | Parathion-ethyl-d10 | ||
|---|---|---|---|---|
| CAS Number | 350820-04-1 | Molecular Weight | 301.322 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C10H4D10NO5PS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 173.5±28.4 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Parathion-ethyl-d10 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.0±0.0 °C at 760 mmHg |
| Molecular Formula | C10H4D10NO5PS |
| Molecular Weight | 301.322 |
| Flash Point | 173.5±28.4 °C |
| Exact Mass | 301.095795 |
| PSA | 115.41000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | LCCNCVORNKJIRZ-MWUKXHIBSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H330-H311-H372-H410 |
| Precautionary Statements | P260-P273-P280-P284-P301 + P310 + P330-P304 + P340 + P310 |
| Hazard Codes | T+: Very toxic;N: Dangerous for the environment; |
| Risk Phrases | R24 |
| Safety Phrases | 28-36/37-45-60-61 |
| RIDADR | UN 3278 6.1/PG 1 |
| O,O-Diethyl-d10 O-(4-nitrophenyl) phosphorothioate |
| Phosphorothioic acid, O,O-diethyl-d O-(4-nitrophenyl) ester |
| (4-nitrophenoxy)-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-λ<sup>5</sup>-phosphane |
| O,O-Bis[(H)ethyl] O-(4-nitrophenyl) phosphorothioate |