N-Chloroacetyl-3-(trifluoromethyl)aniline structure
|
Common Name | N-Chloroacetyl-3-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 351-38-2 | Molecular Weight | 237.606 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 326.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H7ClF3NO | Melting Point | 62,5-64°C | |
| MSDS | N/A | Flash Point | 151.2±27.9 °C | |
| Name | 2-Chloro-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.4±42.0 °C at 760 mmHg |
| Melting Point | 62,5-64°C |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.606 |
| Flash Point | 151.2±27.9 °C |
| Exact Mass | 237.016830 |
| PSA | 29.10000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | MOEJRZLPQODXGM-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S23-S36/37/39 |
| HS Code | 2924299090 |
|
~94%
N-Chloroacetyl-... CAS#:351-38-2 |
| Literature: DESIGNMEDIX, INC.; STATE OF OREGON, ACTING BY AND THROUGH THE STATE BOARD Of HIGHER EDUCATION ON BEHALF OF PORTLAND STATE UNIVERSITY; PEYTON, David, H.; BURGESS, Steven, J. Patent: WO2011/34971 A1, 2011 ; Location in patent: Page/Page column 30-31 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00084932 |
| N1-[3-(trifluoromethyl)phenyl]-2-chloroacetamide |
| Acetamide, 2-chloro-N-[3-(trifluoromethyl)phenyl]- |
| 2-Chloro-N-[3-(trifluoromethyl)phenyl]acetamide |
| N-Chloroacetyl-3-(trifluoromethyl)aniline |
| 2-CHLORO-ALPHA,ALPHA,ALPHA-TRIFLUORO-M-ACETOTOLUIDIDE |