6-FLUORO-8-NITROCHROMONE-3-CARBOXALDEHY&
6-FLUORO-8-NITROCHROMONE-3-CARBOXALDEHY& structure
|
Common Name | 6-FLUORO-8-NITROCHROMONE-3-CARBOXALDEHY& | ||
|---|---|---|---|---|
| CAS Number | 351003-07-1 | Molecular Weight | 237.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4FNO5 | Melting Point | 110-114ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 110-114ºC(lit.) |
|---|---|
| Molecular Formula | C10H4FNO5 |
| Molecular Weight | 237.14100 |
| Exact Mass | 237.00700 |
| PSA | 93.10000 |
| LogP | 2.17600 |
| InChIKey | MFTIKIFELZBYLH-UHFFFAOYSA-N |
| SMILES | O=Cc1coc2c([N+](=O)[O-])cc(F)cc2c1=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932999099 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD03094008 |
| 6-Fluoro-8-nitrochromone-3-carboxaldehyde |
| 4H-1-Benzopyran-3-carboxaldehyde,6-fluoro-8-nitro-4-oxo |
| 6-FLUORO-8-NITROCHROMONE-3-CARBOXALDEHYD |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: Molecular weight of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 237.14100. |
| Q: What is the English name of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: The English name of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde. |
| Q: What is the CAS number of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: CAS number of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 351003-07-1. |
| Q: What is the polar surface area (PSA) of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: Polar surface area (PSA) of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 93.10000. |
| Q: What is the molecular formula of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: Molecular formula of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is C10H4FNO5. |
| Q: What English synonyms does 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde have? |
| A: English synonyms of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde: MFCD03094008, 6-Fluoro-8-nitrochromone-3-carboxaldehyde, 4H-1-Benzopyran-3-carboxaldehyde,6-fluoro-8-nitro-4-oxo, 6-FLUORO-8-NITROCHROMONE-3-CARBOXALDEHYD. |
| Q: What is the InChIKey of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: InChIKey of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is MFTIKIFELZBYLH-UHFFFAOYSA-N. |
| Q: What is the melting point of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: Melting point of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 110-114ºC(lit.). |
| Q: What is the SMILES notation of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: SMILES notation of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is O=Cc1coc2c([N+](=O)[O-])cc(F)cc2c1=O. |
| Q: What is the LogP of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde? |
| A: LogP of 6-fluoro-8-nitro-4-oxochromene-3-carbaldehyde is 2.17600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |