4-NITRO-2-(1H-PYRAZOL-3-YL)PHENOL structure
|
Common Name | 4-NITRO-2-(1H-PYRAZOL-3-YL)PHENOL | ||
|---|---|---|---|---|
| CAS Number | 351003-12-8 | Molecular Weight | 205.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7N3O3 | Melting Point | 211-214ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-(1,2-dihydropyrazol-3-ylidene)-4-nitrocyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 211-214ºC(lit.) |
|---|---|
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17000 |
| Exact Mass | 205.04900 |
| PSA | 94.73000 |
| LogP | 2.21370 |
| InChIKey | NPTPVROZEGBZIS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(-c2ccn[nH]2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03094028 |
| Phenol,4-nitro-2-(1H-pyrazol-3-yl) |
| 4-Nitro-2-(1H-pyrazol-3-yl)phenol |
| 4-NITRO-2-(1H-PYRAZOL-3-YL)PHENOL 97 |