2-Bromo-4-(trifluoromethyl)benzenesulfonamide structure
|
Common Name | 2-Bromo-4-(trifluoromethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 351003-63-9 | Molecular Weight | 304.08400 | |
| Density | 1.809g/cm3 | Boiling Point | 343.3ºC at 760mmHg | |
| Molecular Formula | C7H5BrF3NO2S | Melting Point | 160-164 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 161.4ºC | |
| Name | 2-Bromo-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.809g/cm3 |
|---|---|
| Boiling Point | 343.3ºC at 760mmHg |
| Melting Point | 160-164 °C(lit.) |
| Molecular Formula | C7H5BrF3NO2S |
| Molecular Weight | 304.08400 |
| Flash Point | 161.4ºC |
| Exact Mass | 302.91800 |
| PSA | 68.54000 |
| LogP | 3.89640 |
| Index of Refraction | 1.529 |
| InChIKey | IJUIBMWZUXWVLI-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(C(F)(F)F)cc1Br |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-bromo-4-(trifluoromethyl)benzenesulfonamide |
| MFCD03094287 |