3-(2,4-dinitrophenyl)disulfanyl-N-(2-tritylsulfanylethyl)propanamide structure
|
Common Name | 3-(2,4-dinitrophenyl)disulfanyl-N-(2-tritylsulfanylethyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 3513-49-3 | Molecular Weight | 605.74700 | |
| Density | 1.39g/cm3 | Boiling Point | 764.1ºC at 760 mmHg | |
| Molecular Formula | C30H27N3O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 415.9ºC | |
| Name | N-(2-trifluoromethylphenyl)trifluoroacetimidoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 764.1ºC at 760 mmHg |
| Molecular Formula | C30H27N3O5S3 |
| Molecular Weight | 605.74700 |
| Flash Point | 415.9ºC |
| Exact Mass | 605.11100 |
| PSA | 196.64000 |
| LogP | 8.91220 |
| Index of Refraction | 1.703 |
| InChIKey | CEYLRZLPJZWGOC-UHFFFAOYSA-N |
| SMILES | O=C(CCSSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
3-(2,4-dinitrop... CAS#:3513-49-3 |
| Literature: Hiskey,R.G.; Harpp,D.N. Journal of the American Chemical Society, 1965 , vol. 87, p. 3965 - 3969 |
|
~%
3-(2,4-dinitrop... CAS#:3513-49-3 |
| Literature: Hiskey,R.G.; Harpp,D.N. Journal of the American Chemical Society, 1965 , vol. 87, p. 3965 - 3969 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethanimidoyl chloride,2,2,2-trifluoro-N-[2-(trifluoromethyl)phenyl] |
| N-(2-Tritylthio-ethyl)-5-(2,4-dinitro-phenyl)-4,5-dithia-pentanamid |