3-((2,4-Bis(hydroxy(oxido)amino)phenyl)dithio)propanoic acid
Modify Date: 2025-08-25 16:51:43
3-((2,4-Bis(hydroxy(oxido)amino)phenyl)dithio)propanoic acid structure
|
Common Name | 3-((2,4-Bis(hydroxy(oxido)amino)phenyl)dithio)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3513-48-2 | Molecular Weight | 304.30000 | |
| Density | 1.64g/cm3 | Boiling Point | 499.2ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.7ºC | |
| Name | 3-[(2,4-dinitrophenyl)disulfanyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 499.2ºC at 760 mmHg |
| Molecular Formula | C9H8N2O6S2 |
| Molecular Weight | 304.30000 |
| Flash Point | 255.7ºC |
| Exact Mass | 303.98200 |
| PSA | 179.54000 |
| LogP | 3.76440 |
| Index of Refraction | 1.683 |
| InChIKey | IGFLESIBGUALPH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCSSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2930909090 |
|---|
|
~83%
3-((2,4-Bis(hyd... CAS#:3513-48-2 |
| Literature: Nagao, Yoshimitsu; Miyasaka, Tadayo; Seno, Kaoru; Fujita, Eiichi; Shibata, Daisuke; Doi, Etsushiro Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 2439 - 2446 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:3513-49-3| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(2,4-dinitro-phenyldisulfanyl)-propionic acid |
| 3-(2,4-Dinitro-phenyldisulfanyl)-propionsaeure |
| 5-<2,4-Dinitro-phenyl>-4,5-dithiapentansaeure |
| 3-((2,4-Bis(hydroxy(oxido)amino)phenyl)dithio)propanoic acid |