DPTIP structure
|
Common Name | DPTIP | ||
|---|---|---|---|---|
| CAS Number | 351353-48-5 | Molecular Weight | 378.444 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.7±31.5 °C | |
Use of DPTIPDPTIP is a potent and selective N-SMase2 inhibitor and brain penetrant. |
| Name | 2,6-Dimethoxy-4-[4-phenyl-5-(2-thienyl)-1H-imidazol-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 608.3±55.0 °C at 760 mmHg |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.444 |
| Flash Point | 321.7±31.5 °C |
| Exact Mass | 378.103821 |
| LogP | 6.05 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | JMXVHYPSBANVAQ-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3cccs3)[nH]2)cc(OC)c1O |
| Hazard Codes | Xi |
|---|
| 2,6-Dimethoxy-4-[4-phenyl-5-(2-thienyl)-1H-imidazol-2-yl]phenol |
| 2,6-Dimethoxy-4-(5-phenyl-4-thiophen-2-yl-1H-imidazol-2-yl)-phenol |
| Phenol, 2,6-dimethoxy-4-[5-phenyl-4-(2-thienyl)-1H-imidazol-2-yl]- |