aristolic acid structure
|
Common Name | aristolic acid | ||
|---|---|---|---|---|
| CAS Number | 35142-05-3 | Molecular Weight | 296.27400 | |
| Density | 1.442g/cm3 | Boiling Point | 550.1ºC at 760 mmHg | |
| Molecular Formula | C17H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 8-methoxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442g/cm3 |
|---|---|
| Boiling Point | 550.1ºC at 760 mmHg |
| Molecular Formula | C17H12O5 |
| Molecular Weight | 296.27400 |
| Flash Point | 210.3ºC |
| Exact Mass | 296.06800 |
| PSA | 64.99000 |
| LogP | 3.42850 |
| Index of Refraction | 1.726 |
| InChIKey | WNMKOPJJPJHXJX-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1ccc1c(C(=O)O)cc3c(c12)OCO3 |
| HS Code | 2932999099 |
|---|
|
~%
aristolic acid CAS#:35142-05-3 |
| Literature: Priestap, Horacio A.; Barbieri, Manuel A. Journal of Natural Products, 2013 , vol. 76, # 5 p. 965 - 968 |
|
~%
aristolic acid CAS#:35142-05-3 |
| Literature: Achari, Basudeb; Bandyopadhyay, Soumitra; Saha, Chitta R.; Pakrashi, Satyesh C. Heterocycles, 1983 , vol. 20, # 5 p. 771 - 774 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Aristolsaeure I |
| denitroaristolochic acid |
| 1-carboxy-3,4-methylenedioxy-8-methoxyphenanthrene |
| aristofolin E |
| Aristolic acid |
| 3,4-methylenedioxy-8-methoxy-1-phenanthrenecarboxylic acid |