Boc-L-Phenylalanine amide structure
|
Common Name | Boc-L-Phenylalanine amide | ||
|---|---|---|---|---|
| CAS Number | 35150-06-2 | Molecular Weight | 264.32000 | |
| Density | 1.181 g/cm3 | Boiling Point | 464ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | tert-butyl N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181 g/cm3 |
|---|---|
| Boiling Point | 464ºC at 760 mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 234.4ºC |
| Exact Mass | 264.14700 |
| PSA | 81.42000 |
| LogP | 2.69890 |
| Index of Refraction | 1.529 |
| InChIKey | DHUPSFPAFRFQRO-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BOC-CCK 33 |
| Boc-L-phenylalaninamide |