3-(2-Carboxyethyl)piperidine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 3-(2-Carboxyethyl)piperidine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 352004-58-1 | Molecular Weight | 257.326 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 386.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5±20.4 °C | |
| Name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.4±15.0 °C at 760 mmHg |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.326 |
| Flash Point | 187.5±20.4 °C |
| Exact Mass | 257.162720 |
| PSA | 66.84000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | ZVYVZEUADCRFHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCC(=O)O)C1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-[1-(tert-Butoxycarbonyl)piperidin-3-yl]propanoic acid |
| 3-Piperidinepropanoic acid, 1-[(1,1-dimethylethoxy)carbonyl]- |
| 3-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-piperidinyl)propanoic acid |
| 1-Boc-Piperidin-3-Ylpropionic Acid |
| N-Boc-3-piperidinepropionic acid |
| MFCD02179008 |
| N-BOC-3-PIPERIDINEPROPANOIC ACID |