Methyl benzoin structure
|
Common Name | Methyl benzoin | ||
|---|---|---|---|---|
| CAS Number | 3524-62-7 | Molecular Weight | 226.27000 | |
| Density | 1.128 | Boiling Point | 188-189 °C (15 mmHg) | |
| Molecular Formula | C15H14O2 | Melting Point | 47-50 °C | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | benzoin methyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128 |
|---|---|
| Boiling Point | 188-189 °C (15 mmHg) |
| Melting Point | 47-50 °C |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | >230 °F |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.25700 |
| InChIKey | BQZJOQXSCSZQPS-UHFFFAOYSA-N |
| SMILES | COC(C(=O)c1ccccc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AM9350000 |
| Hazard Class | 6.1 |
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Induction of host defences by Rhizobium during ineffective nodulation of pea (Pisum sativum L.) carrying symbiotically defective mutations sym40 (PsEFD), sym33 (PsIPD3/PsCYCLOPS) and sym42.
Protoplasma 252 , 1505-17, (2015) Rhizobia are able to establish a beneficial interaction with legumes by forming a new organ, called the symbiotic root nodule, which is a unique ecological niche for rhizobial nitrogen fixation. Rhizo... |
|
|
Gas chromatography with parallel hard and soft ionization mass spectrometry.
Rapid Commun. Mass Spectrom. 29(1) , 91-9, (2014) Mass spectrometric identification of compounds in chromatography can be obtained from molecular masses from soft ionization mass spectrometry techniques such as field ionization (FI) and fragmentation... |
|
|
A new strategy to determine the protein mutation site using matrix-assisted laser desorption ionization in-source decay: derivatization by ionic liquid.
Anal. Chim. Acta 865 , 31-8, (2015) Matrix-assisted laser desorption ionization (MALDI) time-of-flight mass spectrometry (TOF-MS) can be considered as state of the art in the field of proteins and peptides analysis. In this work, we hav... |
| EINECS 222-538-7 |
| Benzoin methyl ether |
| 1,2-diphenyl-2-methoxyethanone |
| qcu3 |
| 2-methoxy-1,2-diphenyl-1-ethanone |
| 2-methoxy-1,2-diphenylethanone |
| nissocurembo |
| MFCD00008492 |
| Methyl benzoin |
| O-Methylbenzoin |
| Benzoin methyl ester |
| Benzoinbismethylether |
| Benzoinemethylether |
| benzoin monomethyl ether |
| Methyl benzoin ether |
| 2-Methoxy-2-phenylacetophenone |