6-(Chloromethyl)-2-phenylpyrimidin-4-ol structure
|
Common Name | 6-(Chloromethyl)-2-phenylpyrimidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 35252-98-3 | Molecular Weight | 220.65500 | |
| Density | 1.3 | Boiling Point | 345.8ºC at 760 mmHg | |
| Molecular Formula | C11H9ClN2O | Melting Point | 196-199ºC | |
| MSDS | N/A | Flash Point | 162.9ºC | |
| Name | 6-(chloromethyl)-2-phenyl-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3 |
|---|---|
| Boiling Point | 345.8ºC at 760 mmHg |
| Melting Point | 196-199ºC |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.65500 |
| Flash Point | 162.9ºC |
| Exact Mass | 220.04000 |
| PSA | 46.01000 |
| LogP | 2.58800 |
| Index of Refraction | 1.625 |
| InChIKey | BFGHBQQZXUJZNO-UHFFFAOYSA-N |
| SMILES | O=c1cc(CCl)nc(-c2ccccc2)[nH]1 |
| HS Code | 2933599090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloromethyl-6-hydroxy-2-phenylpyrimidine |