2'-SULFAMOYL-BIPHENYL-4-CARBOXYLICACID structure
|
Common Name | 2'-SULFAMOYL-BIPHENYL-4-CARBOXYLICACID | ||
|---|---|---|---|---|
| CAS Number | 352615-90-8 | Molecular Weight | 277.29600 | |
| Density | 1.413g/cm3 | Boiling Point | 549.2ºC at 760 mmHg | |
| Molecular Formula | C13H11NO4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 286ºC | |
| Name | 4-(2-sulfamoylphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 549.2ºC at 760 mmHg |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.29600 |
| Flash Point | 286ºC |
| Exact Mass | 277.04100 |
| PSA | 105.84000 |
| LogP | 3.48030 |
| Index of Refraction | 1.634 |
| InChIKey | LYHKPAIFSGHBPU-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc(C(=O)O)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
2'-SULFAMOYL-BI... CAS#:352615-90-8 |
| Literature: EP1577302 A1, ; Page/Page column 102 ; |
|
~%
2'-SULFAMOYL-BI... CAS#:352615-90-8 |
| Literature: US2005/20645 A1, ; |
|
~%
2'-SULFAMOYL-BI... CAS#:352615-90-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 3 p. 217 - 221 |
|
~%
2'-SULFAMOYL-BI... CAS#:352615-90-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 3 p. 217 - 221 |
|
~%
2'-SULFAMOYL-BI... CAS#:352615-90-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 3 p. 217 - 221 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| OR6989 |
| 2'-Sulfamoyl-biphenyl-4-carboxylic acid |
| 2'-aminosulfonyl-1,1'-biphenyl-4-carboxylic acid |