2-Chloro-4,6-dinitroaniline structure
|
Common Name | 2-Chloro-4,6-dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 3531-19-9 | Molecular Weight | 217.567 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 376.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H4ClN3O4 | Melting Point | 157-159 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 181.4±26.5 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 2-Chloro-4,6-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.3±37.0 °C at 760 mmHg |
| Melting Point | 157-159 °C(lit.) |
| Molecular Formula | C6H4ClN3O4 |
| Molecular Weight | 217.567 |
| Flash Point | 181.4±26.5 °C |
| Exact Mass | 216.989029 |
| PSA | 117.66000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | LHRIICYSGQGXSX-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H373-H411 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX9250000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Sorting of polymorphs based on mechanical properties. Trimorphs of 6-chloro-2,4-dinitroaniline.
Chem. Commun. (Camb.) (19) , 2439-41, (2005) Mechanical shearing of crystals of a polymorph with a layered structure may be used to separate them from harder crystals of a visually indistinguishable polymorph that resist such shearing. |
|
|
Molecular crystals: pinching polymorphs.
Nat. Mater. 4(6) , 427-8, (2005)
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| ANILINE,6-CHLORO-2,4-DINITRO |
| 2,4-dinitro-6-chloroaniline |
| MFCD00075113 |
| EINECS 222-564-9 |
| Benzenamine,2-chloro-4,6-dinitro |
| 2-Chloro-4,6-dinitroaniline |
| 6-chloro-2,4-nitroaniline |
| 6-Chloro-2,4-dinitroaniline |