sodium,9H-fluoren-9-ide structure
|
Common Name | sodium,9H-fluoren-9-ide | ||
|---|---|---|---|---|
| CAS Number | 3531-83-7 | Molecular Weight | 188.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Na | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,9H-fluoren-9-ide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9Na |
|---|---|
| Molecular Weight | 188.20000 |
| Exact Mass | 188.06000 |
| LogP | 3.26770 |
| InChIKey | HATJEFSJJJVAOG-UHFFFAOYSA-N |
| SMILES | [Na+].c1ccc2c(c1)[cH-]c1ccccc12 |
|
~%
sodium,9H-fluor... CAS#:3531-83-7 |
| Literature: Morton; Little Journal of the American Chemical Society, 1949 , vol. 71, p. 487 |
|
~%
sodium,9H-fluor... CAS#:3531-83-7 |
| Literature: France; Maitland; Tucker Journal of the Chemical Society, 1937 , p. 1739,1741 |
|
~%
sodium,9H-fluor... CAS#:3531-83-7 |
| Literature: France; Maitland; Tucker Journal of the Chemical Society, 1937 , p. 1739,1741 |
|
~%
sodium,9H-fluor... CAS#:3531-83-7 |
| Literature: Schlenk; Bergmann Justus Liebigs Annalen der Chemie, 1928 , vol. 463, p. 208 |
| Precursor 5 | |
|---|---|
| DownStream 8 | |
| Diphenylenmethylnatrium |
| Fluoren-9-ylnatrium |
| fluoren-9-yl sodium |
| 9-Natrium-fluoren |
| Sodium,9H-fluoren-9-yl |