1-(9H-fluoren-9-yl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(9H-fluoren-9-yl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 386-83-4 | Molecular Weight | 262.22700 | |
| Density | 1.338 | Boiling Point | N/A | |
| Molecular Formula | C15H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(9H-fluoren-9-yl)-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338 |
|---|---|
| Molecular Formula | C15H9F3O |
| Molecular Weight | 262.22700 |
| Exact Mass | 262.06100 |
| PSA | 17.07000 |
| LogP | 3.93030 |
| InChIKey | GMKFBDYQYADPBN-UHFFFAOYSA-N |
| SMILES | O=C(C1c2ccccc2-c2ccccc21)C(F)(F)F |
| HS Code | 2914700090 |
|---|
|
~%
1-(9H-fluoren-9... CAS#:386-83-4 |
| Literature: Greenhow et al. Journal of the Chemical Society, 1953 , p. 3099,3104 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2,2-Trifluor-1-fluoren-9-yl-aethanon |
| 2,2,2-trifluoro-1-fluoren-9-yl-ethanone |