3-hydroxy-3-phenyl-2-pyridin-2-yl-isoindol-1-one structure
|
Common Name | 3-hydroxy-3-phenyl-2-pyridin-2-yl-isoindol-1-one | ||
|---|---|---|---|---|
| CAS Number | 3532-41-0 | Molecular Weight | 302.32700 | |
| Density | 1.355g/cm3 | Boiling Point | 538.7ºC at 760 mmHg | |
| Molecular Formula | C19H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-3-phenyl-2-pyridin-2-ylisoindol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 538.7ºC at 760 mmHg |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.32700 |
| Exact Mass | 302.10600 |
| PSA | 53.43000 |
| LogP | 3.00040 |
| Index of Refraction | 1.697 |
| InChIKey | WEBJZBBHPCIJJY-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(O)(c2ccccc2)N1c1ccccn1 |
|
~95%
3-hydroxy-3-phe... CAS#:3532-41-0 |
| Literature: Deglopper, Kimberly S.; Dennis, Joseph M.; Johnson, Jeffrey B. Tetrahedron Letters, 2014 , vol. 55, # 10 p. 1843 - 1845 |
|
~%
3-hydroxy-3-phe... CAS#:3532-41-0 |
| Literature: Ogata; Matsumoto; Tawara European Journal of Medicinal Chemistry, 1981 , vol. 16, # 4 p. 373 - 378 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-hydroxy-3-phenyl-2-pyridin-2-yl-2,3-dihydro-isoindol-1-one |
| 3-hydroxy-3-phenyl-2-(pyridin-2-yl)-2,3-dihydro-1h-isoindol-1-one |
| 3-Hydroxy-3-phenyl-2-<pyridyl-(2)>-phthalimidin |
| 3-hydroxy-3-phenyl-2-(pyridin-2-yl)isoindolin-1-one |