N,N,N-Triheptyl-1-heptanaminium iodide
Modify Date: 2026-07-14 20:52:43
N,N,N-Triheptyl-1-heptanaminium iodide structure
|
Common Name | N,N,N-Triheptyl-1-heptanaminium iodide | ||
|---|---|---|---|---|
| CAS Number | 3535-83-9 | Molecular Weight | 537.687 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H60IN | Melting Point | 122-126 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Triheptyl-1-heptanaminium iodideTetraheptylammonium Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | tetraheptylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraheptylammonium Iodide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 122-126 °C |
|---|---|
| Molecular Formula | C28H60IN |
| Molecular Weight | 537.687 |
| Exact Mass | 537.377014 |
| LogP | 6.68880 |
| InChIKey | KCSOHLKZTZMKQA-UHFFFAOYSA-M |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[I-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~%
N,N,N-Triheptyl... CAS#:3535-83-9 |
| Literature: Journal of Organic Chemistry, , vol. 25, p. 849 - 850 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| tetraheptylazanium iodide |
| N,N,N-Triheptyl-1-heptanaminium iodide |
| Tetra-n-heptylammonium iodide |
| ACMC-1AEUW |
| 1-Heptanaminium, N,N,N-triheptyl-, iodide |
| Tetraheptylammonium iodide |
| 1-Heptanaminium,N,N,N-triheptyl-,iodide |
| EINECS 222-570-1 |
| Ammonium,tetraheptyl-,iodide |
| N,N,N-Triheptylheptan-1-aminium iodide |
| NHep4(1+)*I(1-) |
| 1-Heptanaminium, N,N,N-triheptyl-, iodide (1:1) |
| AC1L2SAR |
| MFCD00041984 |