dimethyl 2,2-bis(prop-2-enyl)propanedioate
dimethyl 2,2-bis(prop-2-enyl)propanedioate structure
|
Common Name | dimethyl 2,2-bis(prop-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 35357-77-8 | Molecular Weight | 212.24200 | |
| Density | 1.023g/cm3 | Boiling Point | 209.7ºC at 760mmHg | |
| Molecular Formula | C11H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 2,2-bis(prop-2-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 209.7ºC at 760mmHg |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24200 |
| Flash Point | 87.2ºC |
| Exact Mass | 212.10500 |
| PSA | 52.60000 |
| LogP | 1.47100 |
| Index of Refraction | 1.452 |
| InChIKey | SZIREXDQZMDDJM-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(=O)OC)C(=O)OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2917190090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 5 | |
CAS#:106-95-6
CAS#:108-59-8
CAS#:591-87-7
CAS#:107428-06-8
CAS#:40637-56-7
CAS#:771477-49-7
CAS#:35466-83-2
CAS#:1746-13-0
CAS#:1469-70-1
CAS#:107-05-1![2,7-Dioxaspiro[4.4]nonane-1,6-dione,3,8-dimethyl structure](https://image.chemsrc.com/caspic/466/3048-76-8.png)
CAS#:3048-76-8
CAS#:84646-68-4
CAS#:58101-60-3
CAS#:25125-21-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| dimethyl bis-allyl malonate |
| Dimethyl diallylmalonate |
| dimethyl 2,2-di(2-propenyl)malonate |
| dimethyl hept-1,6-dienyl-4,4-dicarboxylate |
| methyl 2-methoxycarbonyl-2-allyl-4-pentenoate |
| 2,2-diallylmalonic acid dimethyl ester |
| EINECS 252-526-7 |
| (MeO2C)2C(CH2CH=CH2)2 |
| dimethyl 2,2-diallylmalonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: InChIKey of dimethyl 2,2-bis(prop-2-enyl)propanedioate is SZIREXDQZMDDJM-UHFFFAOYSA-N. |
| Q: What is the LogP of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: LogP of dimethyl 2,2-bis(prop-2-enyl)propanedioate is 1.47100. |
| Q: What is the SMILES notation of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: SMILES notation of dimethyl 2,2-bis(prop-2-enyl)propanedioate is C=CCC(CC=C)(C(=O)OC)C(=O)OC. |
| Q: What English synonyms does dimethyl 2,2-bis(prop-2-enyl)propanedioate have? |
| A: English synonyms of dimethyl 2,2-bis(prop-2-enyl)propanedioate: dimethyl bis-allyl malonate, Dimethyl diallylmalonate, dimethyl 2,2-di(2-propenyl)malonate, dimethyl hept-1,6-dienyl-4,4-dicarboxylate, methyl 2-methoxycarbonyl-2-allyl-4-pentenoate, 2,2-diallylmalonic acid dimethyl ester, EINECS 252-526-7, (MeO2C)2C(CH2CH=CH2)2, dimethyl 2,2-diallylmalonate. |
| Q: What is the boiling point of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: Boiling point of dimethyl 2,2-bis(prop-2-enyl)propanedioate is 209.7ºC at 760mmHg. |
| Q: What are the upstream materials of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: Related upstream materials(CAS) of dimethyl 2,2-bis(prop-2-enyl)propanedioate: 106-95-6;108-59-8;591-87-7;107428-06-8;40637-56-7;771477-49-7;35466-83-2;1746-13-0;1469-70-1;107-05-1. |
| Q: What is the safety information for dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: Safety information for dimethyl 2,2-bis(prop-2-enyl)propanedioate: S24/25. |
| Q: What is the English name of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: The English name of dimethyl 2,2-bis(prop-2-enyl)propanedioate is dimethyl 2,2-bis(prop-2-enyl)propanedioate. |
| Q: What is the polar surface area (PSA) of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: Polar surface area (PSA) of dimethyl 2,2-bis(prop-2-enyl)propanedioate is 52.60000. |
| Q: What is the molecular formula of dimethyl 2,2-bis(prop-2-enyl)propanedioate? |
| A: Molecular formula of dimethyl 2,2-bis(prop-2-enyl)propanedioate is C11H16O4. |