Ethyl 2-amino-3,5-dibromobenzoate structure
|
Common Name | Ethyl 2-amino-3,5-dibromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 353754-49-1 | Molecular Weight | 322.98100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-amino-3,5-dibromobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9Br2NO2 |
|---|---|
| Molecular Weight | 322.98100 |
| Exact Mass | 320.90000 |
| PSA | 52.32000 |
| LogP | 3.55170 |
| InChIKey | NERSGAMVWBINET-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Br)cc(Br)c1N |
|
~86%
Ethyl 2-amino-3... CAS#:353754-49-1 |
| Literature: Nakatsuji, Masaaki; Miura, Yozo; Teki, Yoshio Journal of the Chemical Society, Perkin Transactions 2, 2001 , # 5 p. 738 - 744 |
|
~%
Ethyl 2-amino-3... CAS#:353754-49-1 |
| Literature: Wheeler; Oates Journal of the American Chemical Society, 1910 , vol. 32, p. 772 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3.5-Dibrom-anthranilsaeureaethylester |
| 2-amino-3,5-dibromo-benzoic acid ethyl ester |
| 2-Amino-3,5-dibrom-benzoesaeure-aethylester |
| 2-Amino-3.5-dibrom-benzolsulfon-amid |
| 2-AMINO-3,5-DIBROMO-BENZENESULFONAMIDE |
| 2-Amino-3,5-dibrom-benzol-sulfonsaeureamid |
| 2-(ethoxycarbonyl)-4,6-dibromoaniline |