3-(3-hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one structure
|
Common Name | 3-(3-hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 35400-60-3 | Molecular Weight | 304.29500 | |
| Density | 1.409g/cm3 | Boiling Point | 553.1ºC at 760mmHg | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | 3-(3-hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 553.1ºC at 760mmHg |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.29500 |
| Flash Point | 207ºC |
| Exact Mass | 304.09500 |
| PSA | 107.22000 |
| LogP | 2.33310 |
| Index of Refraction | 1.659 |
| InChIKey | RWKSTZADJBEXSQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1O |
|
~80%
3-(3-hydroxy-4-... CAS#:35400-60-3 |
| Literature: Nakamura, Yoshimasa; Watanabe, Shigeo; Miyake, Nobuyuki; Kohno, Hiroyuki; Osawa, Toshihiko Journal of Agricultural and Food Chemistry, 2003 , vol. 51, # 11 p. 3309 - 3312 |
|
~%
3-(3-hydroxy-4-... CAS#:35400-60-3 |
| Literature: US2005/267047 A1, ; Page/Page column 16 ; |
| 3-(3-hydroxy-4-methoxy-phenyl)-1-(2,4,6-trihydroxy-phenyl)-propan-1-one |
| Hesperetin-dihydrochalcon |
| 3-(3-Hydroxy-4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone |
| 3-Hydroxy-4-O-methyl-phloretin |
| Hesperetin dihydrochalcone |
| 3-(3-Hydroxy-4-methoxy-phenyl)-1-(2,4,6-trihydroxy-phenyl)-propan-1-on |