1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester structure
|
Common Name | 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 3543-72-4 | Molecular Weight | 291.302 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 481.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7±23.2 °C | |
| Name | ethyl 4-(1-methyl-5-nitrobenzimidazol-2-yl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.0±25.0 °C at 760 mmHg |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.302 |
| Flash Point | 244.7±23.2 °C |
| Exact Mass | 291.121918 |
| PSA | 89.94000 |
| LogP | 2.73 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | VJVBGSJZBDBEIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCc1nc2cc([N+](=O)[O-])ccc2n1C |
| HS Code | 2933990090 |
|---|
|
~93%
1-Methyl-5-nitr... CAS#:3543-72-4 |
| Literature: Heyl Chemisch-pharmazeutische Fabrik GmbH and Co. KG; Frey, Michael; Walther, Dirk-Detlef Patent: US2014/31560 A1, 2014 ; Location in patent: Paragraph 0101; 0102 ; |
|
~%
1-Methyl-5-nitr... CAS#:3543-72-4 |
| Literature: US2014/31560 A1, ; |
|
~%
1-Methyl-5-nitr... CAS#:3543-72-4 |
| Literature: US2014/31560 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 4-(1-methyl-5-nitro-1H-benzimidazol-2-yl)butanoate |
| 1H-Benzimidazole-2-butanoic acid, 1-methyl-5-nitro-, ethyl ester |
| 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic acid ethyl ester |