1H,1H-Nonafluoro-1-pentanol structure
|
Common Name | 1H,1H-Nonafluoro-1-pentanol | ||
|---|---|---|---|---|
| CAS Number | 355-28-2 | Molecular Weight | 250.06200 | |
| Density | 1.584g/cm3 | Boiling Point | 92.8ºC at 760mmHg | |
| Molecular Formula | C5H3F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9.9ºC | |
| Name | 1h,1h-perfluoropentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.584g/cm3 |
|---|---|
| Boiling Point | 92.8ºC at 760mmHg |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06200 |
| Flash Point | 9.9ºC |
| Exact Mass | 250.00400 |
| PSA | 20.23000 |
| LogP | 2.44690 |
| Index of Refraction | 1.3 |
| InChIKey | PJRIQFXPYMVWOU-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2905590090 |
|
~%
1H,1H-Nonafluor... CAS#:355-28-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 56, # 1 p. 73 - 83 |
|
~%
1H,1H-Nonafluor... CAS#:355-28-2 |
| Literature: US2666797 , ; |
|
~%
1H,1H-Nonafluor... CAS#:355-28-2 |
| Literature: Journal of Physical Chemistry, , vol. 99, # 20 p. 8311 - 8316 Journal of the Chemical Society, Faraday Transactions, , vol. 91, # 17 p. 2761 - 2766 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1H,1H-Nonafluoro-1-pentanol |
| 1H,1H-Perfluoro-1-pentanol |
| (Perfluorobutyl)methanol |
| 1H,1H-Nonafluor-pentan-1-ol |
| 1,1-dihydroperfluoroamyl alcohol |
| 4:1 FTOH |
| 1H,1H-NONAFLUOROHEPTAN-1-OL |
| 1H,1H-NONAFLUOROPENTANOL-1 |
| 2,2,3,3,4,4,5,5,5-nonafluoropentanol |
| 2,2,3,3,4,4,5,5,5-Nonafluor-pentanol |
| 1H,1H-nonafluoro-pentan-1-ol |
| 2,2,3,3,4,4,5,5,5-nonafluoro-pentan-1-ol |