1H-Tridecafluorohexane structure
|
Common Name | 1H-Tridecafluorohexane | ||
|---|---|---|---|---|
| CAS Number | 355-37-3 | Molecular Weight | 320.05100 | |
| Density | 1,6843 g/cm3 | Boiling Point | 71°C | |
| Molecular Formula | C6HF13 | Melting Point | -93ºC | |
| MSDS | N/A | Flash Point | >110 | |
| Name | 1h-perfluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1,6843 g/cm3 |
|---|---|
| Boiling Point | 71°C |
| Melting Point | -93ºC |
| Molecular Formula | C6HF13 |
| Molecular Weight | 320.05100 |
| Flash Point | >110 |
| Exact Mass | 319.98700 |
| LogP | 4.35500 |
| Index of Refraction | 1.3 |
| InChIKey | XJSRKJAHJGCPGC-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2903399090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00142632 |
| 1H-Tridecafluorohexane |
| 1-Hydrotridecafluorohexane |
| 1H-Tridecafluoro-n-hexane |
| 1-H-perfluoroheptane |
| trideca-1,1,1,2,2,3,3,4,4,5,5,6,6-fluorohexane |
| TRIDECAFLUOROHEXANE |
| Perfluorohexyl-1-hydride |
| EINECS 206-581-9 |
| hydroperfluorohexane |