perfluorohexanoyl fluoride structure
|
Common Name | perfluorohexanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 355-38-4 | Molecular Weight | 316.04400 | |
| Density | 1.66 g/cm3 | Boiling Point | 77.5ºC at 760 mmHg | |
| Molecular Formula | C6F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 18ºC | |
| Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66 g/cm3 |
|---|---|
| Boiling Point | 77.5ºC at 760 mmHg |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.04400 |
| Flash Point | 18ºC |
| Exact Mass | 315.97600 |
| PSA | 17.07000 |
| LogP | 3.58600 |
| Index of Refraction | 1.264 |
| InChIKey | XATLHBQMSOZWBO-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Undecafluor-hexanoylfluorid |
| EINECS 206-582-4 |
| undecafluoro-hexanoyl fluoride |
| Hexanoyl fluoride,undecafluoro |
| perfluoro-n-caproyl fluoride |
| Perfluorohexanoyl Fluoride |