perfluorohexanoyl fluoride
perfluorohexanoyl fluoride structure
|
Common Name | perfluorohexanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 355-38-4 | Molecular Weight | 316.04400 | |
| Density | 1.66 g/cm3 | Boiling Point | 77.5ºC at 760 mmHg | |
| Molecular Formula | C6F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 18ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.66 g/cm3 |
|---|---|
| Boiling Point | 77.5ºC at 760 mmHg |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.04400 |
| Flash Point | 18ºC |
| Exact Mass | 315.97600 |
| PSA | 17.07000 |
| LogP | 3.58600 |
| Index of Refraction | 1.264 |
| InChIKey | XATLHBQMSOZWBO-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2915900090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Undecafluor-hexanoylfluorid |
| EINECS 206-582-4 |
| undecafluoro-hexanoyl fluoride |
| Hexanoyl fluoride,undecafluoro |
| perfluoro-n-caproyl fluoride |
| Perfluorohexanoyl Fluoride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 355-38-4. |
| Q: What is the molecular weight of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: Molecular weight of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 316.04400. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What English synonyms does 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride have? |
| A: English synonyms of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride: Undecafluor-hexanoylfluorid, EINECS 206-582-4, undecafluoro-hexanoyl fluoride, Hexanoyl fluoride,undecafluoro, perfluoro-n-caproyl fluoride, Perfluorohexanoyl Fluoride. |
| Q: What is the LogP of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: LogP of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 3.58600. |
| Q: What is the molecular formula of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: Molecular formula of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is C6F12O. |
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is XATLHBQMSOZWBO-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: Boiling point of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 77.5ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 17.07000. |
| Q: What is the English name of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride? |
| A: The English name of 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoyl fluoride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |