1,6-Dichloroperfluorohexane structure
|
Common Name | 1,6-Dichloroperfluorohexane | ||
|---|---|---|---|---|
| CAS Number | 355-40-8 | Molecular Weight | 370.95100 | |
| Density | 1.717g/cm3 | Boiling Point | 113-114ºC | |
| Molecular Formula | C6Cl2F12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63.4ºC | |
| Name | 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.717g/cm3 |
|---|---|
| Boiling Point | 113-114ºC |
| Molecular Formula | C6Cl2F12 |
| Molecular Weight | 370.95100 |
| Flash Point | 63.4ºC |
| Exact Mass | 369.91900 |
| LogP | 5.19080 |
| Index of Refraction | 1.307 |
| InChIKey | SNCGKZWVZZPGDQ-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903799090 |
|
~%
1,6-Dichloroper... CAS#:355-40-8 |
| Literature: Zapevalov,A.Ya. et al. Zhurnal Organicheskoi Khimii, 1978 , vol. 14, p. 259 - 262,239 - 242 |
|
~%
1,6-Dichloroper... CAS#:355-40-8 |
| Literature: Zapevalov,A.Ya. et al. Zhurnal Organicheskoi Khimii, 1978 , vol. 14, p. 259 - 262,239 - 242 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,6-dichloro-1H,6H-dodecafluoro-hexane |
| PC9238 |
| 1,6-Dichloroperfluorohexane |