1h,1h-perfluorononylamine structure
|
Common Name | 1h,1h-perfluorononylamine | ||
|---|---|---|---|---|
| CAS Number | 355-47-5 | Molecular Weight | 449.10800 | |
| Density | 1.64g/cm3 | Boiling Point | 172.2ºC at 760mmHg | |
| Molecular Formula | C9H4F17N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 68.2ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 172.2ºC at 760mmHg |
| Molecular Formula | C9H4F17N |
| Molecular Weight | 449.10800 |
| Flash Point | 68.2ºC |
| Exact Mass | 449.00700 |
| PSA | 26.02000 |
| LogP | 5.65480 |
| Index of Refraction | 1.291 |
| InChIKey | IHVFAVFXCUPMEN-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | 2-8℃ |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | 22-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2921199090 |
|
~%
1h,1h-perfluoro... CAS#:355-47-5 |
| Literature: Minnesota Mining and Mfg. Co. Patent: US2691043 , 1950 ; |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H,1H-Perfluorononylamine |
| 1-Amino-1H,1H-heptadecafluor-nonan |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononylamine |
| MFCD01319146 |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluor-nonylamin |