Undecafluoroiodocyclohexane structure
|
Common Name | Undecafluoroiodocyclohexane | ||
|---|---|---|---|---|
| CAS Number | 355-69-1 | Molecular Weight | 407.95100 | |
| Density | 2.18 | Boiling Point | 112ºC | |
| Molecular Formula | C6F11I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 51.1ºC | |
| Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-iodocyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.18 |
|---|---|
| Boiling Point | 112ºC |
| Molecular Formula | C6F11I |
| Molecular Weight | 407.95100 |
| Flash Point | 51.1ºC |
| Exact Mass | 407.88700 |
| LogP | 4.27730 |
| Index of Refraction | 1.363 |
| InChIKey | WYRAAMGCHCLHRD-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(I)C(F)(F)C1(F)F |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903890090 |
|
~%
Undecafluoroiod... CAS#:355-69-1 |
| Literature: Journal of Fluorine Chemistry, , vol. 130, # 3 p. 301 - 307 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| iodoundecafluorocyclohexane |
| U0080 |
| Perfluoroiodocyclohexane |
| Iodoperfluorocyclohexane |
| Perfluorocyclohexyl iodide |
| Undecafluor-jod-cyclohexan |
| Undecafluoroiodocyclohexane |