(3,5-dimethyl-6-trimethylsilylphosphinin-2-yl)-trimethylsilane structure
|
Common Name | (3,5-dimethyl-6-trimethylsilylphosphinin-2-yl)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 355126-09-9 | Molecular Weight | 268.48200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25PSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-dimethyl-6-trimethylsilylphosphinin-2-yl)-trimethylsilane |
|---|
| Molecular Formula | C13H25PSi2 |
|---|---|
| Molecular Weight | 268.48200 |
| Exact Mass | 268.12300 |
| PSA | 34.14000 |
| LogP | 5.09370 |
| InChIKey | NMEVTZGPWKDJMK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c([Si](C)(C)C)pc1[Si](C)(C)C |
|
~79%
(3,5-dimethyl-6... CAS#:355126-09-9 |
| Literature: Cataldo; Choua; Berclaz; Geoffroy; Mezailles; Ricard; Mathey; Le Floch Journal of the American Chemical Society, 2001 , vol. 123, # 27 p. 6654 - 6661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |