N-(pyridin-2-ylmethyl)adamantan-1-amine structure
|
Common Name | N-(pyridin-2-ylmethyl)adamantan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 355382-19-3 | Molecular Weight | 242.35900 | |
| Density | 1.11g/cm3 | Boiling Point | 359.9ºC at 760 mmHg | |
| Molecular Formula | C16H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | N-(pyridin-2-ylmethyl)adamantan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 359.9ºC at 760 mmHg |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.35900 |
| Flash Point | 171.5ºC |
| Exact Mass | 242.17800 |
| PSA | 24.92000 |
| LogP | 3.53090 |
| Index of Refraction | 1.587 |
| InChIKey | JZNCCSXXPQMODA-UHFFFAOYSA-N |
| SMILES | c1ccc(CNC23CC4CC(CC(C4)C2)C3)nc1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| adamantan-1-yl-pyridin-2-ylmethylamine |