4-(1-methylpropyl)-2-nitrophenol structure
|
Common Name | 4-(1-methylpropyl)-2-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 3555-18-8 | Molecular Weight | 195.21500 | |
| Density | 1.174g/cm3 | Boiling Point | 260.1ºC at 760mmHg | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.2ºC | |
| Name | 4-butan-2-yl-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 260.1ºC at 760mmHg |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Flash Point | 106.2ºC |
| Exact Mass | 195.09000 |
| PSA | 66.05000 |
| LogP | 3.33710 |
| Index of Refraction | 1.556 |
| InChIKey | GCDCKEORRIGZKI-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(O)c([N+](=O)[O-])c1 |
| HS Code | 2908999090 |
|---|
|
~%
4-(1-methylprop... CAS#:3555-18-8 |
| Literature: Kirby,A.H.M. et al. Tetrahedron, Supplement, 1964 , vol. 6, p. 483 - 508 |
|
~%
4-(1-methylprop... CAS#:3555-18-8 |
| Literature: Reilly; Hickinbottom Journal of the Chemical Society, 1920 , vol. 117, p. 133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 222-611-3 |
| 2-Nitro-4-sek.-butyl-phenol |
| 4-sec-Butyl-2-nitro-phenol |
| 2-Nitro-4-sec.-butyl-phenol |
| Phenol,4-sec-butyl-2-nitro |