(di-tert-butyl)dimethylstannane structure
|
Common Name | (di-tert-butyl)dimethylstannane | ||
|---|---|---|---|---|
| CAS Number | 35569-11-0 | Molecular Weight | 566.68800 | |
| Density | N/A | Boiling Point | 207ºC at 760mmHg | |
| Molecular Formula | C38H34N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.6ºC | |
| Name | 2'-(dibenzylamino)-6'-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 207ºC at 760mmHg |
|---|---|
| Molecular Formula | C38H34N2O3 |
| Molecular Weight | 566.68800 |
| Flash Point | 77.6ºC |
| Exact Mass | 566.25700 |
| PSA | 42.01000 |
| LogP | 8.30760 |
| InChIKey | BYZIKHGJWTVMSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Sn](C)(C)C(C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| di-tert-butyl-dimethyl stannane |
| Di-tert-butyl-dimethyl-stannan |
| D3204 |
| EINECS 251-971-4 |
| di-tert-butyldimethyltin |