Benzenepropanoic acid, b-(2,4-dimethoxyphenyl)-3,4-dimethoxy- structure
|
Common Name | Benzenepropanoic acid, b-(2,4-dimethoxyphenyl)-3,4-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 35582-73-1 | Molecular Weight | 346.37400 | |
| Density | 1.181g/cm3 | Boiling Point | 507.1ºC at 760 mmHg | |
| Molecular Formula | C19H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.2ºC | |
| Name | 2,4,4'-Trimethoxychalcon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 507.1ºC at 760 mmHg |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.37400 |
| Flash Point | 178.2ºC |
| Exact Mass | 346.14200 |
| PSA | 74.22000 |
| LogP | 3.32760 |
| Index of Refraction | 1.547 |
| InChIKey | HZYKHVBWHCHXCR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(CC(=O)O)c2ccc(OC)c(OC)c2)c(OC)c1 |
|
~%
Benzenepropanoi... CAS#:35582-73-1 |
| Literature: Elsworth; Lamchen Journal of the South African Chemical Institute, 1972 , vol. 25, p. 31,42 |
|
~%
Benzenepropanoi... CAS#:35582-73-1 |
| Literature: Elsworth; Lamchen Journal of the South African Chemical Institute, 1972 , vol. 25, p. 31,42 |
| 2,4,4'-Trimethoxychalcone |