1h,1h-heptafluorobutyl acetate structure
|
Common Name | 1h,1h-heptafluorobutyl acetate | ||
|---|---|---|---|---|
| CAS Number | 356-06-9 | Molecular Weight | 242.09200 | |
| Density | 1.435 g/cm3 | Boiling Point | 105ºC | |
| Molecular Formula | C6H5F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1h,1h-heptafluorobutyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435 g/cm3 |
|---|---|
| Boiling Point | 105ºC |
| Molecular Formula | C6H5F7O2 |
| Molecular Weight | 242.09200 |
| Exact Mass | 242.01800 |
| PSA | 26.30000 |
| LogP | 2.38240 |
| Index of Refraction | 1.311 |
| InChIKey | JJRRHZPKVSFERJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 10-36/37/38 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1993 |
| HS Code | 2915390090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2,2,3,3,4,4,4-Heptafluorobutylacetate |