2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)butan-1-amine structure
|
Common Name | 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 356-08-1 | Molecular Weight | 381.11000 | |
| Density | 1.549g/cm3 | Boiling Point | 125ºC at 760mmHg | |
| Molecular Formula | C8H5F14N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 29.4ºC | |
| Name | 2,2,3,3,4,4,4-heptafluoro-N-(2,2,3,3,4,4,4-heptafluorobutyl)butan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 125ºC at 760mmHg |
| Molecular Formula | C8H5F14N |
| Molecular Weight | 381.11000 |
| Flash Point | 29.4ºC |
| Exact Mass | 381.02000 |
| PSA | 12.03000 |
| LogP | 4.63270 |
| Index of Refraction | 1.297 |
| InChIKey | ZBFYNWWMCBFWFV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CNCC(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2921199090 |
|
~%
2,2,3,3,4,4,4-h... CAS#:356-08-1 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2782184 , 1953 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| pc1024 |