5,5,6,6,7,7,7-heptafluoroheptane-2,4-dione structure
|
Common Name | 5,5,6,6,7,7,7-heptafluoroheptane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 356-30-9 | Molecular Weight | 254.10200 | |
| Density | 1.438g/cm3 | Boiling Point | 146.2ºC at 760mmHg | |
| Molecular Formula | C7H5F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 50.6ºC | |
| Name | 5,5,6,6,7,7,7-heptafluoroheptane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 146.2ºC at 760mmHg |
| Molecular Formula | C7H5F7O2 |
| Molecular Weight | 254.10200 |
| Flash Point | 50.6ºC |
| Exact Mass | 254.01800 |
| PSA | 34.14000 |
| LogP | 2.36750 |
| InChIKey | QHBCZMRCKGKVSR-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5,5,6,6,7,7,7-heptafluoro-heptane-2,4-dione |
| 5,5,6,6,7,7,7-Heptafluor-heptan-2,4-dion |
| MFCD00511282 |