2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid
2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid structure
|
Common Name | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 356-33-2 | Molecular Weight | 204.07600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4F4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H4F4O4 |
|---|---|
| Molecular Weight | 204.07600 |
| Exact Mass | 204.00500 |
| PSA | 63.60000 |
| LogP | 0.51460 |
| InChIKey | JQYHTWJFTRVWFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:356-36-5
CAS#:1893-38-5
CAS#:755-73-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: Related downstream products(CAS) of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid: 356-36-5;1893-38-5;755-73-7. |
| Q: What is the CAS number of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: CAS number of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is 356-33-2. |
| Q: What is the English name of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: The English name of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid. |
| Q: What is the LogP of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: LogP of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is 0.51460. |
| Q: What is the molecular weight of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: Molecular weight of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is 204.07600. |
| Q: What is the polar surface area (PSA) of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: Polar surface area (PSA) of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is 63.60000. |
| Q: What is the SMILES notation of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: SMILES notation of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is COC(=O)C(F)(F)C(F)(F)C(=O)O. |
| Q: What is the molecular formula of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: Molecular formula of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is C5H4F4O4. |
| Q: What is the Chinese name of 356-33-2? |
| A: Chinese name of 356-33-2 is 356-33-2. |
| Q: What is the InChIKey of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid? |
| A: InChIKey of 2,2,3,3-tetrafluoro-4-methoxy-4-oxobutanoic acid is JQYHTWJFTRVWFC-UHFFFAOYSA-N. |